| id | C00034590 |
|---|---|
| Name | Lyratyl acetate |
| CAS RN | 20384-05-8 |
| Standard InChI | InChI=1S/C12H18O2/c1-6-12(9(2)3)7-10(4)8-14-11(5)13/h6-7,12H,1-2,8H2,3-5H3/b10-7+/t12-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C12H18O2/c1-6-12(9(2)3)7-10(4)8-14-11(5)13/h6-7,12H,1-2,8H2,3-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3562 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Santolina corsica Jordan et Fourr | 41642 | Asteraceae | asterids | Viridiplantae |