| id | C00034994 |
|---|---|
| Name | 10-Shogaol / [10]-Shogaol |
| CAS RN | 36752-54-2 |
| Standard InChI | InChI=1S/C21H32O3/c1-3-4-5-6-7-8-9-10-11-12-19(22)15-13-18-14-16-20(23)21(17-18)24-2/h11-12,14,16-17,23H,3-10,13,15H2,1-2H3/b12-11+ |
| Standard InChI (Main Layer) | InChI=1S/C21H32O3/c1-3-4-5-6-7-8-9-10-11-12-19(22)15-13-18-14-16-20(23)21(17-18)24-2/h11-12,14,16-17,23H,3-10,13,15H2,1-2H3 |
| Phytochemical cluster | No. 32 |
|---|---|
| KCF-S cluster | No. 293 |
| By standard InChI | CHEMBL24226 |
|---|---|
| By standard InChI Main Layer | CHEMBL24226 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Zingiberaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zingiber officinale ROSC. | 4650 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL24226 |
CHEMBL1108200
(1)
|
1 / 0 |
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL24226 |
CHEMBL1108193
(1)
CHEMBL1108194
(1)
CHEMBL1108195 (1) CHEMBL1108196 (1) CHEMBL1108197 (1) CHEMBL1108198 (1) |
1 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #612244 | Inflammatory bowel disease 13; ibd13 |
P08183
|
| #614674 | Periodic fever, menstrual cycle-dependent |
P08908
|