| id | C00035161 |
|---|---|
| Name | Senkyunolide I |
| CAS RN | 94596-28-8 |
| Standard InChI | InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3/b9-4-/t8-,11+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C12H16O4/c1-2-3-4-9-7-5-6-8(13)11(14)10(7)12(15)16-9/h4,8,11,13-14H,2-3,5-6H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7445 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL499010 CHEMBL513448 CHEMBL499542 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Pinaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pseudolarix kaempferi Gord. | 3354 | Pinaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL499542 |
CHEMBL977664
(1)
|
0 / 0 |