| id | C00035299 |
|---|---|
| Name | Dulxanthone D |
| CAS RN | 182051-07-6 |
| Standard InChI | InChI=1S/C19H18O6/c1-9(2)4-5-11-16-15(8-13(22)19(11)24-3)25-14-7-10(20)6-12(21)17(14)18(16)23/h4,6-8,20-22H,5H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O6/c1-9(2)4-5-11-16-15(8-13(22)19(11)24-3)25-14-7-10(20)6-12(21)17(14)18(16)23/h4,6-8,20-22H,5H2,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL110491 |
|---|---|
| By standard InChI Main Layer | CHEMBL110491 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Clusiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Garcinia mangostana | 58228 | Clusiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL110491 |
CHEMBL644937
(1)
|
2 / 2 |
| O60906 | Sphingomyelin phosphodiesterase 2 | Enzyme | CHEMBL110491 |
CHEMBL751444
(1)
|
0 / 0 |