| id | C00035574 |
|---|---|
| Name | Dehydrogingerdione |
| CAS RN | 189128-20-9 |
| Standard InChI | InChI=1S/C13H14O4/c1-9(14)7-11(15)5-3-10-4-6-12(16)13(8-10)17-2/h3-8,15-16H,1-2H3/b5-3+,11-7+ |
| Standard InChI (Main Layer) | InChI=1S/C13H14O4/c1-9(14)7-11(15)5-3-10-4-6-12(16)13(8-10)17-2/h3-8,15-16H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4323 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL211958 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Zingiberaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zingiber officinale | 94328 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04760 | Lactoylglutathione lyase | Enzyme | CHEMBL211958 |
CHEMBL1670272
(1)
|
0 / 0 |