| id | C00035690 | 
|---|---|
| Name | Methyl caprate | 
| CAS RN | 110-42-9 | 
| Standard InChI | InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 869 | 
| By standard InChI | CHEMBL2137647 | 
|---|---|
| By standard InChI Main Layer | CHEMBL2137647 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Solanaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Mandragora autumnalis | 389206 | Solanaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL2137647 | CHEMBL2114890
                        (1) | 0 / 0 |