| id | C00035690 |
|---|---|
| Name | Methyl caprate |
| CAS RN | 110-42-9 |
| Standard InChI | InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 869 |
| By standard InChI | CHEMBL2137647 |
|---|---|
| By standard InChI Main Layer | CHEMBL2137647 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Solanaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mandragora autumnalis | 389206 | Solanaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL2137647 |
CHEMBL2114890
(1)
|
0 / 0 |