| id | C00035802 |
|---|---|
| Name | alpha-Neocallitropsene / (-)-alpha-Neocallitropsene |
| CAS RN | 830329-97-0 |
| Standard InChI | InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h7,13-14H,1,5-6,8-10H2,2-4H3/t13-,14-,15?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24/c1-11(2)14-6-5-13(4)15(14)9-7-12(3)8-10-15/h7,13-14H,1,5-6,8-10H2,2-4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 151 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Acoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acorus calanus L. | 4464 | Acoraceae | Liliopsida | Viridiplantae |