| id | C00035970 |
|---|---|
| Name | 7-Hydroxymitragynin / 7alpha-Hydroxy-7H-mitragynine |
| CAS RN | 174418-82-7 |
| Standard InChI | InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6570 |
| By standard InChI | CHEMBL61630 |
|---|---|
| By standard InChI Main Layer | CHEMBL61630 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mitragyna speciosa | 170351 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL61630 |
CHEMBL756037
(1)
CHEMBL857861
(1)
|
0 / 0 |