| id | C00035975 |
|---|---|
| Name | 7-Methoxy-beta-Carboline 1-propionic acid |
| CAS RN | 137756-13-9 |
| Standard InChI | InChI=1S/C15H14N2O3/c1-20-9-2-3-10-11-6-7-16-12(4-5-14(18)19)15(11)17-13(10)8-9/h2-3,6-8,17H,4-5H2,1H3,(H,18,19) |
| Standard InChI (Main Layer) | InChI=1S/C15H14N2O3/c1-20-9-2-3-10-11-6-7-16-12(4-5-14(18)19)15(11)17-13(10)8-9/h2-3,6-8,17H,4-5H2,1H3,(H,18,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1551 |
| By standard InChI | CHEMBL504997 |
|---|---|
| By standard InChI Main Layer | CHEMBL504997 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| family name | count |
|---|---|
| Simaroubaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Eurycoma harmandiana | 458530 | Simaroubaceae | rosids | Viridiplantae |
| Eurycoma longifolia | 458531 | Simaroubaceae | rosids | Viridiplantae |
| Eurycoma longifolida | 458530 | Simaroubaceae | rosids | Viridiplantae |