| id | C00036115 |
|---|---|
| Name | Epiphyllic acid |
| CAS RN | 152367-34-5 |
| Standard InChI | InChI=1S/C18H14O8/c19-11-2-1-7(4-12(11)20)15-9-6-14(22)13(21)5-8(9)3-10(17(23)24)16(15)18(25)26/h1-6,15-16,19-22H,(H,23,24)(H,25,26)/t15-,16-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H14O8/c19-11-2-1-7(4-12(11)20)15-9-6-14(22)13(21)5-8(9)3-10(17(23)24)16(15)18(25)26/h1-6,15-16,19-22H,(H,23,24)(H,25,26) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3867 |
| By standard InChI | CHEMBL172933 |
|---|---|
| By standard InChI Main Layer | CHEMBL172933 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Embryophyta | 2 |
| family name | count |
|---|---|
| Lepicoleaceae | 1 |
| Lepidoziaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Lepicolea ochroleuca | 255962 | Lepicoleaceae | Embryophyta | Viridiplantae |
| Lepidozia incurvata | 56926 | Lepidoziaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL172933 |
CHEMBL857580
(1)
|
0 / 0 |
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL172933 |
CHEMBL667219
(1)
|
0 / 0 |