| id | C00036157 |
|---|---|
| Name | Moracin N |
| CAS RN | 135248-05-4 |
| Standard InChI | InChI=1S/C19H18O4/c1-11(2)3-4-12-5-13-8-18(23-19(13)10-17(12)22)14-6-15(20)9-16(21)7-14/h3,5-10,20-22H,4H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O4/c1-11(2)3-4-12-5-13-8-18(23-19(13)10-17(12)22)14-6-15(20)9-16(21)7-14/h3,5-10,20-22H,4H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 15 |
| By standard InChI | CHEMBL465881 |
|---|---|
| By standard InChI Main Layer | CHEMBL465881 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| Morus sp. | 3487 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL465881 |
CHEMBL949646
(1)
|
2 / 2 |