| id | C00036268 |
|---|---|
| Name | (-)-6-Chloroepicatechin |
| CAS RN | 334475-78-4 |
| Standard InChI | InChI=1S/C15H13ClO6/c16-13-10(19)5-12-7(14(13)21)4-11(20)15(22-12)6-1-2-8(17)9(18)3-6/h1-3,5,11,15,17-21H,4H2/t11-,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H13ClO6/c16-13-10(19)5-12-7(14(13)21)4-11(20)15(22-12)6-1-2-8(17)9(18)3-6/h1-3,5,11,15,17-21H,4H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 52 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Geraniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Geranium pratense subsp.finitimum (Woronow) Knuth | 4027 | Geraniaceae | rosids | Viridiplantae |