| id | C00036512 |
|---|---|
| Name | 3,4-Dihydro-3-methoxypaederoside / (-)-3,4-Dihydro-3-methoxypaederoside |
| CAS RN | 438240-83-6 |
| Standard InChI | InChI=1S/C19H26O12S/c1-26-16-11-10-7(28-15(11)24)3-6(5-27-19(25)32-2)9(10)17(30-16)31-18-14(23)13(22)12(21)8(4-20)29-18/h3,7-14,16-18,20-23H,4-5H2,1-2H3/t7-,8+,9+,10-,11+,12+,13-,14+,16-,17-,18-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H26O12S/c1-26-16-11-10-7(28-15(11)24)3-6(5-27-19(25)32-2)9(10)17(30-16)31-18-14(23)13(22)12(21)8(4-20)29-18/h3,7-14,16-18,20-23H,4-5H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2193 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Paederia scandens | 284589 | Rubiaceae | asterids | Viridiplantae |
| Saprosma scortechinii | 358842 | Rubiaceae | asterids | Viridiplantae |