| id | C00036664 |
|---|---|
| Name | 8-Epiisolippidiol |
| CAS RN | 89837-56-9 |
| Standard InChI | InChI=1S/C15H22O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7-14,16-17H,1,4-5H2,2-3H3/t7-,8+,9+,10+,11-,12+,13-,14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7-14,16-17H,1,4-5H2,2-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 608 |
| By standard InChI | CHEMBL406387 |
|---|---|
| By standard InChI Main Layer | CHEMBL406387 CHEMBL1441727 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Crepis mollis | 268022 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1441727 |
CHEMBL1794584
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|