| id | C00036910 |
|---|---|
| Name | cis-Miyabenol A |
| CAS RN | 351415-09-3 |
| Standard InChI | InChI=1S/C56H42O12/c57-33-10-1-28(2-11-33)3-18-41-44(65)19-20-45-49(41)52(55(66-45)30-6-14-35(59)15-7-30)43-25-40(64)27-47-51(43)53(56(68-47)31-8-16-36(60)17-9-31)42-24-39(63)26-46-50(42)48(32-21-37(61)23-38(62)22-32)54(67-46)29-4-12-34(58)13-5-29/h1-27,48,52-65H/b18-3+/t48-,52-,53+,54+,55+,56-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C56H42O12/c57-33-10-1-28(2-11-33)3-18-41-44(65)19-20-45-49(41)52(55(66-45)30-6-14-35(59)15-7-30)43-25-40(64)27-47-51(43)53(56(68-47)31-8-16-36(60)17-9-31)42-24-39(63)26-46-50(42)48(32-21-37(61)23-38(62)22-32)54(67-46)29-4-12-34(58)13-5-29/h1-27,48,52-65H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 93 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Cyperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Carex pendula | 312760 | Cyperaceae | Liliopsida | Viridiplantae |