| id | C00037144 | 
|---|---|
| Name | Ferutidin / Jaeschkeanadiol p-methoxybenzoate | 
| CAS RN | 53947-82-3 | 
| Standard InChI | InChI=1S/C23H32O4/c1-15(2)23(25)13-12-22(4)11-10-16(3)14-19(20(22)23)27-21(24)17-6-8-18(26-5)9-7-17/h6-10,15,19-20,25H,11-14H2,1-5H3/t19-,20+,22-,23+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C23H32O4/c1-15(2)23(25)13-12-22(4)11-10-16(3)14-19(20(22)23)27-21(24)17-6-8-18(26-5)9-7-17/h6-10,15,19-20,25H,11-14H2,1-5H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 327 | 
| By standard InChI | CHEMBL465265 | 
|---|---|
| By standard InChI Main Layer | CHEMBL465265 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Ferula kuhistanica | 52470 | Apiaceae | asterids | Viridiplantae | 
| Ferula kumistanica | 52470 | Apiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P03372 | Estrogen receptor | NR3A1 | CHEMBL465265 | CHEMBL1004750
                        (1) | 1 / 1 |