id | C00037261 |
---|---|
Name | Heraclenin |
CAS RN | 2880-49-1 |
Standard InChI | InChI=1S/C16H14O5/c1-16(2)11(21-16)8-19-15-13-10(5-6-18-13)7-9-3-4-12(17)20-14(9)15/h3-7,11H,8H2,1-2H3/t11-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C16H14O5/c1-16(2)11(21-16)8-19-15-13-10(5-6-18-13)7-9-3-4-12(17)20-14(9)15/h3-7,11H,8H2,1-2H3 |
Phytochemical cluster | No. 25 |
---|---|
KCF-S cluster | No. 2896 |
By standard InChI | CHEMBL500034 |
---|---|
By standard InChI Main Layer | CHEMBL346814 CHEMBL500034 |
By LinkDB |
---|
By CAS RN | C047845 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Angelica ursina Maxim | 40948 | Apiaceae | asterids | Viridiplantae |
Atalantia ceylanica | 76951 | Rutaceae | rosids | Viridiplantae |
Ferula sumbul | 371383 | Apiaceae | asterids | Viridiplantae |
Heracleum pinnatum | 376875 | Apiaceae | asterids | Viridiplantae |
Opopanax chironium | 63018 | Apiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P56817 | Beta-secretase 1 | A1A | CHEMBL500034 |
CHEMBL1936881
(1)
|
0 / 0 |
P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL346814 |
CHEMBL1613829
(1)
|
0 / 0 |