id | C00037269 |
---|---|
Name | Hexadecanamide |
CAS RN | 629-54-9 |
Standard InChI | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
Standard InChI (Main Layer) | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1606 |
By standard InChI | CHEMBL32605 |
---|---|
By standard InChI Main Layer | CHEMBL32605 |
By LinkDB |
---|
By CAS RN | C014025 |
---|
class name | count |
---|---|
rosids | 1 |
Viridiplantae | 1 |
family name | count |
---|---|
Rutaceae | 1 |
Cladophoraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Boronella koniambiensis | 1226048 | Rutaceae | rosids | Viridiplantae |
Rhizoclonium hieroglyphicum | 162074 | Cladophoraceae | Viridiplantae | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P34972 | Cannabinoid receptor 2 | Cannabinoid receptor | CHEMBL32605 |
CHEMBL657303
(1)
|
0 / 0 |
P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL32605 |
CHEMBL657503
(1)
|
0 / 0 |
P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL32605 |
CHEMBL1614211
(1)
|
0 / 0 |