| id | C00037269 |
|---|---|
| Name | Hexadecanamide |
| CAS RN | 629-54-9 |
| Standard InChI | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
| Standard InChI (Main Layer) | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1606 |
| By standard InChI | CHEMBL32605 |
|---|---|
| By standard InChI Main Layer | CHEMBL32605 |
| By LinkDB |
|---|
| By CAS RN | C014025 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Viridiplantae | 1 |
| family name | count |
|---|---|
| Rutaceae | 1 |
| Cladophoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Boronella koniambiensis | 1226048 | Rutaceae | rosids | Viridiplantae |
| Rhizoclonium hieroglyphicum | 162074 | Cladophoraceae | Viridiplantae | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34972 | Cannabinoid receptor 2 | Cannabinoid receptor | CHEMBL32605 |
CHEMBL657303
(1)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL32605 |
CHEMBL657503
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL32605 |
CHEMBL1614211
(1)
|
0 / 0 |