| id | C00037287 | 
|---|---|
| Name | Hyacinthacine C1 / (+)-Hyacinthacine C1 | 
| CAS RN | 240117-30-0 | 
| Standard InChI | InChI=1S/C9H17NO5/c1-3-6(12)8(14)5-9(15)7(13)4(2-11)10(3)5/h3-9,11-15H,2H2,1H3/t3-,4-,5-,6-,7-,8-,9+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C9H17NO5/c1-3-6(12)8(14)5-9(15)7(13)4(2-11)10(3)5/h3-9,11-15H,2H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 753 | 
| By standard InChI | CHEMBL388095 | 
|---|---|
| By standard InChI Main Layer | CHEMBL388095 CHEMBL227057 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Hyacinthaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Muscari armeniacum | 156613 | Hyacinthaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL388095 CHEMBL227057 | CHEMBL906425
                        (2) | 1 / 2 |