| id | C00037550 | 
|---|---|
| Name | Nigrumin-5-ferulate | 
| CAS RN | 437763-39-8 | 
| Standard InChI | InChI=1S/C21H25NO10/c1-29-15-8-12(2-4-14(15)24)3-5-17(25)31-11-13(9-22)6-7-30-21-20(28)19(27)18(26)16(10-23)32-21/h2-6,8,16,18-21,23-24,26-28H,7,10-11H2,1H3/b5-3+,13-6+/t16-,18-,19+,20-,21-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C21H25NO10/c1-29-15-8-12(2-4-14(15)24)3-5-17(25)31-11-13(9-22)6-7-30-21-20(28)19(27)18(26)16(10-23)32-21/h2-6,8,16,18-21,23-24,26-28H,7,10-11H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 504 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Grossulariaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Ribes nigrum | 78511 | Grossulariaceae | eudicotyledons | Viridiplantae |