| id | C00037572 |
|---|---|
| Name | Octadecanamide |
| CAS RN | 124-26-5 |
| Standard InChI | InChI=1S/C18H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H2,19,20) |
| Standard InChI (Main Layer) | InChI=1S/C18H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H2,19,20) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1606 |
| By standard InChI | CHEMBL88311 |
|---|---|
| By standard InChI Main Layer | CHEMBL88311 |
| By LinkDB | C13846 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Viridiplantae | 1 |
| family name | count |
|---|---|
| Cladophoraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rhizoclonium hieroglyphicum | 162074 | Cladophoraceae | Viridiplantae | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL88311 |
CHEMBL1794376
(1)
|
2 / 3 |