| id | C00037616 |
|---|---|
| Name | Peperomin E / (+)-Peperomin E |
| CAS RN | 220736-94-7 |
| Standard InChI | InChI=1S/C22H20O8/c1-11-14(8-26-22(11)23)19(12-4-15(24-2)20-17(6-12)27-9-29-20)13-5-16(25-3)21-18(7-13)28-10-30-21/h4-7,14,19H,1,8-10H2,2-3H3/t14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H20O8/c1-11-14(8-26-22(11)23)19(12-4-15(24-2)20-17(6-12)27-9-29-20)13-5-16(25-3)21-18(7-13)28-10-30-21/h4-7,14,19H,1,8-10H2,2-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1888 |
| By standard InChI | CHEMBL521941 |
|---|---|
| By standard InChI Main Layer | CHEMBL521941 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 3 |
| family name | count |
|---|---|
| Piperaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peperomia dindigulensis | 13196 | Piperaceae | Magnoliophyta | Viridiplantae |
| Peperomia dindygulensis Miq. | 13196 | Piperaceae | Magnoliophyta | Viridiplantae |
| Peperomia sui | 13196 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25963 | NF-kappa-B inhibitor alpha | Other cytosolic protein | CHEMBL521941 |
CHEMBL1057324
(1)
CHEMBL1057325
(1)
|
1 / 2 |
| O14920 | Inhibitor of nuclear factor kappa-B kinase subunit beta | Other serine/threonine protein kinase | CHEMBL521941 |
CHEMBL1057332
(1)
|
0 / 0 |
| O15111 | Inhibitor of nuclear factor kappa-B kinase subunit alpha | Other serine/threonine protein kinase | CHEMBL521941 |
CHEMBL1057330
(1)
|
1 / 1 |