| id | C00037676 |
|---|---|
| Name | p-Propoxy benzoic acid |
| CAS RN | 5438-19-7 |
| Standard InChI | InChI=1S/C10H12O3/c1-2-7-13-9-5-3-8(4-6-9)10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C10H12O3/c1-2-7-13-9-5-3-8(4-6-9)10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2930 |
| By standard InChI | CHEMBL112328 |
|---|---|
| By standard InChI Main Layer | CHEMBL112328 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Aizoaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Trianthema portulacastrum | 3548 | Aizoaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL112328 |
CHEMBL2354287
(1)
|
1 / 1 |