| id | C00037715 |
|---|---|
| Name | Rabdosiin / (-)-Rabdosiin |
| CAS RN | 119152-54-4 |
| Standard InChI | InChI=1S/C36H30O16/c37-21-4-1-15(7-24(21)40)9-29(33(45)46)51-35(49)20-11-18-13-27(43)28(44)14-19(18)31(17-3-6-23(39)26(42)12-17)32(20)36(50)52-30(34(47)48)10-16-2-5-22(38)25(41)8-16/h1-8,11-14,29-32,37-44H,9-10H2,(H,45,46)(H,47,48)/t29-,30-,31-,32-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C36H30O16/c37-21-4-1-15(7-24(21)40)9-29(33(45)46)51-35(49)20-11-18-13-27(43)28(44)14-19(18)31(17-3-6-23(39)26(42)12-17)32(20)36(50)52-30(34(47)48)10-16-2-5-22(38)25(41)8-16/h1-8,11-14,29-32,37-44H,9-10H2,(H,45,46)(H,47,48) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1276 |
| By standard InChI | CHEMBL355103 |
|---|---|
| By standard InChI Main Layer | CHEMBL355103 CHEMBL353926 CHEMBL501243 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Salvia yunnanensis | 342062 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL355103 CHEMBL353926 |
CHEMBL857580
(2)
|
0 / 0 |
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL355103 CHEMBL353926 |
CHEMBL667219
(2)
|
0 / 0 |