| id | C00000379 |
|---|---|
| Name | Allosamidin / (-)-Allosamidin / (-)-Allosamidine |
| CAS RN | 103782-08-7 |
| Standard InChI | InChI=1S/C25H42N4O14/c1-8(33)26-14-17(36)16(35)11(6-31)39-23(14)42-22-12(7-32)40-24(15(19(22)38)27-9(2)34)41-21-10(5-30)20-13(18(21)37)28-25(43-20)29(3)4/h10-24,30-32,35-38H,5-7H2,1-4H3,(H,26,33)(H,27,34)/t10-,11?,12?,13+,14?,15?,16+,17+,18+,19+,20-,21+,22+,23-,24-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H42N4O14/c1-8(33)26-14-17(36)16(35)11(6-31)39-23(14)42-22-12(7-32)40-24(15(19(22)38)27-9(2)34)41-21-10(5-30)20-13(18(21)37)28-25(43-20)29(3)4/h10-24,30-32,35-38H,5-7H2,1-4H3,(H,26,33)(H,27,34) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1357 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL318258 CHEMBL1230997 |
| By LinkDB | C05346 |
|---|
| By CAS RN | C054851 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. AJ9463 | 222559 | Streptomycetaceae | Bacteria | |
| Streptomyces sp. No.1713 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13231 | Chitotriosidase-1 | Enzyme | CHEMBL318258 |
CHEMBL660671
(1)
|
1 / 0 |
| Q9BZP6 | Acidic mammalian chitinase | Enzyme | CHEMBL1230997 |
CHEMBL1291258
(1)
|
0 / 0 |