| id | C00038035 |
|---|---|
| Name | Zanthopyranone |
| CAS RN | 500574-39-0 |
| Standard InChI | InChI=1S/C8H10O4/c1-5-8(11-3)7(9)6(10-2)4-12-5/h4H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C8H10O4/c1-5-8(11-3)7(9)6(10-2)4-12-5/h4H,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4858 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zanthoxylum simulans | 328402 | Rutaceae | rosids | Viridiplantae |