| id | C00003805 |
|---|---|
| Name | Negletein |
| CAS RN | 29550-13-8 |
| Standard InChI | InChI=1S/C16H12O5/c1-20-13-8-12-14(16(19)15(13)18)10(17)7-11(21-12)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O5/c1-20-13-8-12-14(16(19)15(13)18)10(17)7-11(21-12)9-5-3-2-4-6-9/h2-8,18-19H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL296800 |
|---|---|
| By standard InChI Main Layer | CHEMBL296800 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| Annonaceae | 1 |
| Lamiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Centaurea clementei | 41516 | Asteraceae | asterids | Viridiplantae |
| Desmos chinensis | 1179221 | Annonaceae | Magnoliophyta | Viridiplantae |
| Stachys neglecta | 53171 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL296800 |
CHEMBL880106
(1)
|
0 / 0 |