| id | C00038278 |
|---|---|
| Name | 4-Hydroxytremulacin |
| CAS RN | 911697-91-1 |
| Standard InChI | InChI=1S/C27H28O12/c28-13-19-21(31)22(32)23(39-24(33)15-6-2-1-3-7-15)25(38-19)37-18-10-9-17(29)12-16(18)14-36-26(34)27(35)11-5-4-8-20(27)30/h1-3,5-7,9-12,19,21-23,25,28-29,31-32,35H,4,8,13-14H2/t19-,21-,22+,23-,25-,27?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H28O12/c28-13-19-21(31)22(32)23(39-24(33)15-6-2-1-3-7-15)25(38-19)37-18-10-9-17(29)12-16(18)14-36-26(34)27(35)11-5-4-8-20(27)30/h1-3,5-7,9-12,19,21-23,25,28-29,31-32,35H,4,8,13-14H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 679 |
| By standard InChI | CHEMBL466559 |
|---|---|
| By standard InChI Main Layer | CHEMBL466559 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Salicaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dovyalis hebecarpa | 688332 | Salicaceae | rosids | Viridiplantae |
| Itoa orientalis | 179731 | Salicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL466559 |
CHEMBL973285
(1)
|
0 / 3 |