| id | C00003846 |
|---|---|
| Name | 5,7-Dihydroxy-8,2'-dimethoxyflavone |
| CAS RN | 95480-81-2 |
| Standard InChI | InChI=1S/C17H14O6/c1-21-13-6-4-3-5-9(13)14-8-11(19)15-10(18)7-12(20)16(22-2)17(15)23-14/h3-8,18,20H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-21-13-6-4-3-5-9(13)14-8-11(19)15-10(18)7-12(20)16(22-2)17(15)23-14/h3-8,18,20H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL549356 |
|---|---|
| By standard InChI Main Layer | CHEMBL549356 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scutellaria amabilis HARA | 4139 | Lamiaceae | asterids | Viridiplantae |
| Scutellaria discolor | 4139 | Lamiaceae | asterids | Viridiplantae |
| Scutellaria indica | 233892 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08047 | Transcription factor Sp1 | Unclassified protein | CHEMBL549356 |
CHEMBL1058704
(1)
|
0 / 0 |