| id | C00038718 |
|---|---|
| Name | Celaphanol B / (+)-Celaphanol B |
| CAS RN | 244204-42-0 |
| Standard InChI | InChI=1S/C18H22O5/c1-17(9-19)5-4-6-18(2)11-8-13(23-3)12(20)7-10(11)14(21)15(22)16(17)18/h7-8,19-20,22H,4-6,9H2,1-3H3/t17-,18-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H22O5/c1-17(9-19)5-4-6-18(2)11-8-13(23-3)12(20)7-10(11)14(21)15(22)16(17)18/h7-8,19-20,22H,4-6,9H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4786 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Celastraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Celastrus stehanotifolius | 85180 | Celastraceae | rosids | Viridiplantae |