| id | C00003873 |
|---|---|
| Name | 7,3',4',5'-Tetrahydroxyflavone |
| CAS RN | 67858-31-5 |
| Standard InChI | InChI=1S/C15H10O6/c16-8-1-2-9-10(17)6-13(21-14(9)5-8)7-3-11(18)15(20)12(19)4-7/h1-6,16,18-20H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O6/c16-8-1-2-9-10(17)6-13(21-14(9)5-8)7-3-11(18)15(20)12(19)4-7/h1-6,16,18-20H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL398328 |
|---|---|
| By standard InChI Main Layer | CHEMBL398328 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Convolvulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Evolvulus nummularius | 1125910 | Convolvulaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11309 | Serine/threonine-protein kinase pim-1 | Pim | CHEMBL398328 |
CHEMBL926333
(1)
|
0 / 0 |