| id | C00038752 |
|---|---|
| Name | Chlorocyclinone A |
| CAS RN | 950676-23-0 |
| Standard InChI | InChI=1S/C24H19ClO7/c1-5-11-12(24(30)32-4)8-13-16(20(11)27)22(29)17-14(26)7-10-6-9(2)19(25)23(31-3)15(10)18(17)21(13)28/h6-8,26-27H,5H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C24H19ClO7/c1-5-11-12(24(30)32-4)8-13-16(20(11)27)22(29)17-14(26)7-10-6-9(2)19(25)23(31-3)15(10)18(17)21(13)28/h6-8,26-27H,5H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2483 |
| By standard InChI | CHEMBL253120 |
|---|---|
| By standard InChI Main Layer | CHEMBL253120 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp.DSM17045 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL253120 |
CHEMBL943154
(1)
CHEMBL943155
(1)
CHEMBL943156 (1) |
5 / 3 |