| id | C00038899 | 
|---|---|
| Name | Cyclotheonamide A | 
| CAS RN | 129033-04-1 | 
| Standard InChI | InChI=1S/C36H45N9O8/c37-36(38)39-16-4-8-26-31(49)34(52)44-27(19-22-6-2-1-3-7-22)32(50)42-24(18-23-10-13-25(47)14-11-23)12-15-30(48)40-20-28(41-21-46)35(53)45-17-5-9-29(45)33(51)43-26/h1-3,6-7,10-15,21,24,26-29,47H,4-5,8-9,16-20H2,(H,40,48)(H,41,46)(H,42,50)(H,43,51)(H,44,52)(H4,37,38,39)/b15-12+ | 
| Standard InChI (Main Layer) | InChI=1S/C36H45N9O8/c37-36(38)39-16-4-8-26-31(49)34(52)44-27(19-22-6-2-1-3-7-22)32(50)42-24(18-23-10-13-25(47)14-11-23)12-15-30(48)40-20-28(41-21-46)35(53)45-17-5-9-29(45)33(51)43-26/h1-3,6-7,10-15,21,24,26-29,47H,4-5,8-9,16-20H2,(H,40,48)(H,41,46)(H,42,50)(H,43,51)(H,44,52)(H4,37,38,39) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1491 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL436149 CHEMBL317974 CHEMBL342672 CHEMBL434870 | 
| By LinkDB | 
|---|
| By CAS RN | C081986 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Theonellidae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Theonella swinhoei | 37505 | Theonellidae | Metazoa | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL317974 CHEMBL342672 CHEMBL434870 | 
                        CHEMBL812829
                        (1)
                        CHEMBL813520
                        (1)
                         CHEMBL813561 (1) CHEMBL1011444 (1) CHEMBL1290974 (1) CHEMBL2208602 (1)  | 
                      4 / 2 |