| id | C00038899 |
|---|---|
| Name | Cyclotheonamide A |
| CAS RN | 129033-04-1 |
| Standard InChI | InChI=1S/C36H45N9O8/c37-36(38)39-16-4-8-26-31(49)34(52)44-27(19-22-6-2-1-3-7-22)32(50)42-24(18-23-10-13-25(47)14-11-23)12-15-30(48)40-20-28(41-21-46)35(53)45-17-5-9-29(45)33(51)43-26/h1-3,6-7,10-15,21,24,26-29,47H,4-5,8-9,16-20H2,(H,40,48)(H,41,46)(H,42,50)(H,43,51)(H,44,52)(H4,37,38,39)/b15-12+ |
| Standard InChI (Main Layer) | InChI=1S/C36H45N9O8/c37-36(38)39-16-4-8-26-31(49)34(52)44-27(19-22-6-2-1-3-7-22)32(50)42-24(18-23-10-13-25(47)14-11-23)12-15-30(48)40-20-28(41-21-46)35(53)45-17-5-9-29(45)33(51)43-26/h1-3,6-7,10-15,21,24,26-29,47H,4-5,8-9,16-20H2,(H,40,48)(H,41,46)(H,42,50)(H,43,51)(H,44,52)(H4,37,38,39) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1491 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL436149 CHEMBL317974 CHEMBL342672 CHEMBL434870 |
| By LinkDB |
|---|
| By CAS RN | C081986 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Theonellidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Theonella swinhoei | 37505 | Theonellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL317974 CHEMBL342672 CHEMBL434870 |
CHEMBL812829
(1)
CHEMBL813520
(1)
CHEMBL813561 (1) CHEMBL1011444 (1) CHEMBL1290974 (1) CHEMBL2208602 (1) |
4 / 2 |