| id | C00039027 |
|---|---|
| Name | Dihydrobenzofuran |
| CAS RN | 496-16-2 |
| Standard InChI | InChI=1S/C8H8O/c1-2-4-8-7(3-1)5-6-9-8/h1-4H,5-6H2 |
| Standard InChI (Main Layer) | InChI=1S/C8H8O/c1-2-4-8-7(3-1)5-6-9-8/h1-4H,5-6H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8315 |
| By standard InChI | CHEMBL370688 |
|---|---|
| By standard InChI Main Layer | CHEMBL370688 |
| By LinkDB |
|---|
| By CAS RN | C043168 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Xylariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Xylaria sp. #2508 | 37991 | Xylariaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL370688 |
CHEMBL830921
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C043168 | 1544 |
CYP1A2
CP12 P3-450 P450(PA) |
cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | coumaran results in decreased activity of CYP1A2 protein |
decreases activity
|
protein |
15916432
|