| id | C00039035 |
|---|---|
| Name | Diplamine / Diplamine A |
| CAS RN | 123794-30-9 |
| Standard InChI | InChI=1S/C20H17N3O2S/c1-11(24)21-9-8-14-17-16-13(12-5-3-4-6-15(12)23-17)7-10-22-18(16)19(25)20(14)26-2/h3-7,10H,8-9H2,1-2H3,(H,21,24) |
| Standard InChI (Main Layer) | InChI=1S/C20H17N3O2S/c1-11(24)21-9-8-14-17-16-13(12-5-3-4-6-15(12)23-17)7-10-22-18(16)19(25)20(14)26-2/h3-7,10H,8-9H2,1-2H3,(H,21,24) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2743 |
| By standard InChI | CHEMBL124579 |
|---|---|
| By standard InChI Main Layer | CHEMBL124579 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Aizoaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Diplosoma sp. | 3542 | Aizoaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL124579 |
CHEMBL813448
(1)
|
0 / 0 |
| Q02880 | DNA topoisomerase 2-beta | Isomerase | CHEMBL124579 |
CHEMBL813448
(1)
|
0 / 0 |