| id | C00039098 |
|---|---|
| Name | Elaeocarpenine |
| CAS RN | 942293-11-0 |
| Standard InChI | InChI=1S/C16H19NO2/c1-11-5-2-8-14(18)15(11)16(19)12-6-3-9-17-10-4-7-13(12)17/h2,5-6,8,13,18H,3-4,7,9-10H2,1H3/t13-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H19NO2/c1-11-5-2-8-14(18)15(11)16(19)12-6-3-9-17-10-4-7-13(12)17/h2,5-6,8,13,18H,3-4,7,9-10H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7627 |
| By standard InChI | CHEMBL608815 |
|---|---|
| By standard InChI Main Layer | CHEMBL608815 CHEMBL1076554 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Elaeocarpaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Elaeocarpus fuscoides | 26005 | Elaeocarpaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL608815 CHEMBL1076554 |
CHEMBL919363
(1)
CHEMBL1099398
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL608815 CHEMBL1076554 |
CHEMBL1103137
(2)
|
0 / 0 |