| id | C00039133 |
|---|---|
| Name | Epimukulol |
| CAS RN | 1022084-46-3 |
| Standard InChI | InChI=1S/C20H34O/c1-15(2)19-13-12-17(4)10-6-8-16(3)9-7-11-18(5)14-20(19)21/h9-10,14-15,19-21H,6-8,11-13H2,1-5H3/b16-9+,17-10+,18-14+/t19-,20+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H34O/c1-15(2)19-13-12-17(4)10-6-8-16(3)9-7-11-18(5)14-20(19)21/h9-10,14-15,19-21H,6-8,11-13H2,1-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2325 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL563224 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Alcyoniidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sarcophyton flexuosum | 358802 | Alcyoniidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04054 | Phospholipase A2 | Enzyme | CHEMBL563224 |
CHEMBL1026212
(1)
CHEMBL1026996
(1)
|
0 / 0 |