| id | C00039271 |
|---|---|
| Name | Gibberosene G / (-)-Gibberosene G |
| CAS RN | 1005397-96-5 |
| Standard InChI | InChI=1S/C20H32O/c1-15(2)19-11-9-16(3)7-6-8-17(4)13-20(21)14-18(5)10-12-19/h8-9,11,14-15,20-21H,6-7,10,12-13H2,1-5H3/b16-9+,17-8+,18-14+,19-11+ |
| Standard InChI (Main Layer) | InChI=1S/C20H32O/c1-15(2)19-11-9-16(3)7-6-8-17(4)13-20(21)14-18(5)10-12-19/h8-9,11,14-15,20-21H,6-7,10,12-13H2,1-5H3 |
| Phytochemical cluster | No. 42 |
|---|---|
| KCF-S cluster | No. 1048 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL256338 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Alcyoniidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Simularia gibberosa | ||||
| Sinularia gibberosa | 668428 | Alcyoniidae | Metazoa |