| id | C00039272 |
|---|---|
| Name | Gigantamide A |
| CAS RN | 955381-63-2 |
| Standard InChI | InChI=1S/C18H22N2O3/c1-14-13-17(22)20(18(14)23)12-6-5-11-19-16(21)10-9-15-7-3-2-4-8-15/h2-4,7-10,13,17,22H,5-6,11-12H2,1H3,(H,19,21)/b10-9+ |
| Standard InChI (Main Layer) | InChI=1S/C18H22N2O3/c1-14-13-17(22)20(18(14)23)12-6-5-11-19-16(21)10-9-15-7-3-2-4-8-15/h2-4,7-10,13,17,22H,5-6,11-12H2,1H3,(H,19,21) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6905 |
| By standard InChI | CHEMBL249250 |
|---|---|
| By standard InChI Main Layer | CHEMBL249250 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aglaia gigantea | 201006 | Meliaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL249250 |
CHEMBL2341058
(1)
|
0 / 0 |