| id | C00039323 |
|---|---|
| Name | Habbemine A / (+)-Habbemine A |
| CAS RN | 937023-27-3 |
| Standard InChI | InChI=1S/C16H25NO3/c1-12-5-2-7-14(19)16(12)15(20)11-13-6-3-8-17(13)9-4-10-18/h2,7,12-13,16,18H,3-6,8-11H2,1H3/t12-,13-,16+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H25NO3/c1-12-5-2-7-14(19)16(12)15(20)11-13-6-3-8-17(13)9-4-10-18/h2,7,12-13,16,18H,3-6,8-11H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3253 |
| By standard InChI | CHEMBL608816 |
|---|---|
| By standard InChI Main Layer | CHEMBL608814 CHEMBL608816 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Elaeocarpaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Elaeocarpus habbemensis | 26005 | Elaeocarpaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL608814 CHEMBL608816 |
CHEMBL918425
(2)
|
0 / 0 |