| id | C00039383 |
|---|---|
| Name | Hookerianamide J / (+)-Hookerianamide J |
| CAS RN | 1041464-43-0 |
| Standard InChI | InChI=1S/C28H46N2O2/c1-17(2)16-25(31)29-24-13-15-28(5)22-12-14-27(4)20(18(3)30(6)7)10-11-21(27)19(22)8-9-23(28)26(24)32/h10,16,18-19,21-24,26,32H,8-9,11-15H2,1-7H3,(H,29,31)/t18-,19-,21-,22-,23-,24-,26+,27+,28+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H46N2O2/c1-17(2)16-25(31)29-24-13-15-28(5)22-12-14-27(4)20(18(3)30(6)7)10-11-21(27)19(22)8-9-23(28)26(24)32/h10,16,18-19,21-24,26,32H,8-9,11-15H2,1-7H3,(H,29,31) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1661 |
| By standard InChI | CHEMBL496487 |
|---|---|
| By standard InChI Main Layer | CHEMBL496487 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Buxaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sarcococca hookeriana | 153579 | Buxaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06276 | Cholinesterase | Hydrolase | CHEMBL496487 |
CHEMBL998780
(1)
|
0 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL496487 |
CHEMBL998779
(1)
|
1 / 0 |