| id | C00039448 |
|---|---|
| Name | Isomotuporin |
| CAS RN | 923605-40-7 |
| Standard InChI | InChI=1S/C40H57N5O10/c1-10-30-37(49)44-34(40(53)54)26(7)36(48)43-33(22(2)3)38(50)41-28(25(6)35(47)42-29(39(51)52)18-19-32(46)45(30)8)17-16-23(4)20-24(5)31(55-9)21-27-14-12-11-13-15-27/h10-17,20,22,24-26,28-29,31,33-34H,18-19,21H2,1-9H3,(H,41,50)(H,42,47)(H,43,48)(H,44,49)(H,51,52)(H,53,54)/b17-16+,23-20+,30-10-/t24-,25+,26-,28-,29+,31-,33-,34+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C40H57N5O10/c1-10-30-37(49)44-34(40(53)54)26(7)36(48)43-33(22(2)3)38(50)41-28(25(6)35(47)42-29(39(51)52)18-19-32(46)45(30)8)17-16-23(4)20-24(5)31(55-9)21-27-14-12-11-13-15-27/h10-17,20,22,24-26,28-29,31,33-34H,18-19,21H2,1-9H3,(H,41,50)(H,42,47)(H,43,48)(H,44,49)(H,51,52)(H,53,54) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3342 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL430145 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Theonellidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Theonella swinhoei | 37505 | Theonellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL430145 |
CHEMBL766690
(1)
|
0 / 0 |