id | C00040042 |
---|---|
Name | Poliothyrsoside |
CAS RN | 18463-25-7 |
Standard InChI | InChI=1S/C20H22O9/c21-9-12-8-13(22)6-7-14(12)28-20-18(25)17(24)16(23)15(29-20)10-27-19(26)11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2/t15-,16-,17+,18-,20-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H22O9/c21-9-12-8-13(22)6-7-14(12)28-20-18(25)17(24)16(23)15(29-20)10-27-19(26)11-4-2-1-3-5-11/h1-8,15-18,20-25H,9-10H2 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 532 |
By standard InChI | CHEMBL512419 |
---|---|
By standard InChI Main Layer | CHEMBL512419 |
By LinkDB |
---|
By CAS RN | C477961 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Salicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Itoa orientalis | 179731 | Salicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL512419 |
CHEMBL973285
(1)
|
0 / 3 |