| id | C00040124 |
|---|---|
| Name | Pyriferine A |
| CAS RN | 1064663-84-8 |
| Standard InChI | InChI=1S/C16H24N2O7/c1-15(23)7-6-9(24-3)12(20)11(15)13(21)16(2)18-10(19)5-4-8(17)14(22)25-16/h8-9,20,23H,4-7,17H2,1-3H3,(H,18,19) |
| Standard InChI (Main Layer) | InChI=1S/C16H24N2O7/c1-15(23)7-6-9(24-3)12(20)11(15)13(21)16(2)18-10(19)5-4-8(17)14(22)25-16/h8-9,20,23H,4-7,17H2,1-3H3,(H,18,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4702 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL526843 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Tricholomataceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pseudobaeospora pyrifera | 182862 | Tricholomataceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL526843 |
CHEMBL998809
(1)
|
1 / 0 |