| id | C00040470 |
|---|---|
| Name | Terrestrol G |
| CAS RN | 1005338-82-8 |
| Standard InChI | InChI=1S/C14H13ClO5/c15-13-10(12(19)5-8(6-16)14(13)20)4-7-3-9(17)1-2-11(7)18/h1-3,5,16-20H,4,6H2 |
| Standard InChI (Main Layer) | InChI=1S/C14H13ClO5/c15-13-10(12(19)5-8(6-16)14(13)20)4-7-3-9(17)1-2-11(7)18/h1-3,5,16-20H,4,6H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 967 |
| By standard InChI | CHEMBL258424 |
|---|---|
| By standard InChI Main Layer | CHEMBL258424 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Penicillium terrestre | 374132 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P12931 | Proto-oncogene tyrosine-protein kinase Src | Src | CHEMBL258424 |
CHEMBL931467
(1)
|
0 / 0 |
| P35968 | Vascular endothelial growth factor receptor 2 | Vegfr | CHEMBL258424 |
CHEMBL931469
(1)
|
1 / 0 |