| id | C00004079 |
|---|---|
| Name | 7,8,3',4',5'-Pentamethoxyflavone |
| CAS RN | 133342-97-9 |
| Standard InChI | InChI=1S/C20H20O7/c1-22-14-7-6-12-13(21)10-15(27-18(12)20(14)26-5)11-8-16(23-2)19(25-4)17(9-11)24-3/h6-10H,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O7/c1-22-14-7-6-12-13(21)10-15(27-18(12)20(14)26-5)11-8-16(23-2)19(25-4)17(9-11)24-3/h6-10H,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL465255 |
|---|---|
| By standard InChI Main Layer | CHEMBL465255 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Muntingiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Muntingia calabura | 45164 | Muntingiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL465255 |
CHEMBL941407
(1)
|
0 / 1 |