| id | C00040790 |
|---|---|
| Name | 2,3-Dihydroxypropyl oleate |
| CAS RN | 111-03-5 |
| Standard InChI | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| Standard InChI (Main Layer) | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1785 |
| By standard InChI | CHEMBL428593 |
|---|---|
| By standard InChI Main Layer | CHEMBL428593 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bauhinia purpurea L. | 3806 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL428593 |
CHEMBL932557
(1)
|
0 / 3 |
| P14555 | Phospholipase A2, membrane associated | Enzyme | CHEMBL428593 |
CHEMBL932558
(1)
|
0 / 0 |