| id | C00041236 |
|---|---|
| Name | 12,28-Oxaircinal A / (+)-12,28-Oxaircinal A |
| CAS RN | 904299-13-4 |
| Standard InChI | InChI=1S/C26H36N2O2/c29-18-20-16-26-13-8-3-1-2-4-9-14-27-15-12-22(20)25(19-27)17-21-10-6-5-7-11-23(30-26)28(21)24(25)26/h1,3,6,10,16,18,21-24H,2,4-5,7-9,11-15,17,19H2/b3-1-,10-6-/t21-,22-,23+,24?,25-,26-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C26H36N2O2/c29-18-20-16-26-13-8-3-1-2-4-9-14-27-15-12-22(20)25(19-27)17-21-10-6-5-7-11-23(30-26)28(21)24(25)26/h1,3,6,10,16,18,21-24H,2,4-5,7-9,11-15,17,19H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2407 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL497892 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acanthostrongylophora sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL497892 |
CHEMBL980251
(1)
|
0 / 0 |