| id | C00041280 |
|---|---|
| Name | 5-(8Z-Heptadecenyl)-1,3-benzenediol |
| CAS RN | 52483-19-9 |
| Standard InChI | InChI=1S/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-22(24)20-23(25)19-21/h9-10,18-20,24-25H,2-8,11-17H2,1H3/b10-9- |
| Standard InChI (Main Layer) | InChI=1S/C23H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-18-22(24)20-23(25)19-21/h9-10,18-20,24-25H,2-8,11-17H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 652 |
| By standard InChI | CHEMBL462807 |
|---|---|
| By standard InChI Main Layer | CHEMBL462807 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Primulaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Embelia ribes Burm. | 459628 | Primulaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL462807 |
CHEMBL980220
(1)
|
0 / 0 |
| P00734 | Prothrombin | S1A | CHEMBL462807 |
CHEMBL976587
(1)
|
4 / 2 |