| id | C00041572 |
|---|---|
| Name | Grandisine F / (-)-Grandisine F |
| CAS RN | 911682-69-4 |
| Standard InChI | InChI=1S/C16H24N2O2/c1-9-7-10(17)8-13-14(9)16(19)15-11-3-2-5-18(11)6-4-12(15)20-13/h9-12,15H,2-8,17H2,1H3/t9-,10-,11-,12+,15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H24N2O2/c1-9-7-10(17)8-13-14(9)16(19)15-11-3-2-5-18(11)6-4-12(15)20-13/h9-12,15H,2-8,17H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2062 |
| By standard InChI | CHEMBL497516 |
|---|---|
| By standard InChI Main Layer | CHEMBL497516 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Elaeocarpaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Elaeocarpus grandis | 29815 | Elaeocarpaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL497516 |
CHEMBL975645
(1)
|
0 / 0 |